C14H23N3 — CID 138625606
(4R,5S,6S)-12-tert-butyl-5-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene (PubChem CID 138625606) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is (4R,5S,6S)-12-tert-butyl-5-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene.
| Compound Name | (4R,5S,6S)-12-tert-butyl-5-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene |
|---|---|
| PubChem CID | 138625606 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | (4R,5S,6S)-12-tert-butyl-5-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene |
| SMILES | C[C@H]1[C@H]2CCc3c(nnn3C(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C14H23N3/c1-9-10-5-7-12-13(8-6-11(9)10)17(16-15-12)14(2,3)4/h9-11H,5-8H2,1-4H3/t9-,10+,11-/m1/s1 |
| InChIKey | OSBFNUOMDWQXCX-OUAUKWLOSA-N |
| XLogP | 2.79 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |