C17H29B2N3 — CID 174038203
CID 174038203 (PubChem CID 174038203) has the molecular formula C17H29B2N3 and a molecular weight of 297.06 g/mol.
| Compound Name | CID 174038203 |
|---|---|
| PubChem CID | 174038203 |
| Molecular Formula | C17H29B2N3 |
| Molecular Weight | 297.06 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | — |
| SMILES | C[B]C(C)(C)C1[C@H]2CCc3nnn(C(C)(C)[B]C)c3CC[C@@H]12 |
| InChI | InChI=1S/C17H29B2N3/c1-16(2,18-5)15-11-7-9-13-14(10-8-12(11)15)22(21-20-13)17(3,4)19-6/h11-12,15H,7-10H2,1-6H3/t11-,12+,15?/m0/s1 |
| InChIKey | QCCSUBHLPGCIBN-VPUIJTBTSA-N |
| XLogP | 3.41 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.06 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|