C25H18Cl4N2O2 — CID 17025667
methyl 4-[[3,5-bis(3,4-dichlorophenyl)-4-methylpyrazol-1-yl]methyl]benzoate (PubChem CID 17025667) has the molecular formula C25H18Cl4N2O2 and a molecular weight of 520.24 g/mol. Its IUPAC name is methyl 4-[[3,5-bis(3,4-dichlorophenyl)-4-methylpyrazol-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[3,5-bis(3,4-dichlorophenyl)-4-methylpyrazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 17025667 |
| Molecular Formula | C25H18Cl4N2O2 |
| Molecular Weight | 520.24 g/mol |
| Exact Mass | 518.01 |
| IUPAC Name | methyl 4-[[3,5-bis(3,4-dichlorophenyl)-4-methylpyrazol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2nc(-c3ccc(Cl)c(Cl)c3)c(C)c2-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H18Cl4N2O2/c1-14-23(17-7-9-19(26)21(28)11-17)30-31(24(14)18-8-10-20(27)22(29)12-18)13-15-3-5-16(6-4-15)25(32)33-2/h3-12H,13H2,1-2H3 |
| InChIKey | HMOBDBRTDHEFBI-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.24 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |