C7H10INO — CID 170258058
(1S,2S,5R)-3-methyl-3-azabicyclo[3.1.0]hexane-2-carbonyl iodide (PubChem CID 170258058) has the molecular formula C7H10INO and a molecular weight of 251.07 g/mol. Its IUPAC name is (1S,2S,5R)-3-methyl-3-azabicyclo[3.1.0]hexane-2-carbonyl iodide.
| Compound Name | (1S,2S,5R)-3-methyl-3-azabicyclo[3.1.0]hexane-2-carbonyl iodide |
|---|---|
| PubChem CID | 170258058 |
| Molecular Formula | C7H10INO |
| Molecular Weight | 251.07 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | (1S,2S,5R)-3-methyl-3-azabicyclo[3.1.0]hexane-2-carbonyl iodide |
| SMILES | CN1C[C@@H]2C[C@@H]2[C@H]1C(=O)I |
| InChI | InChI=1S/C7H10INO/c1-9-3-4-2-5(4)6(9)7(8)10/h4-6H,2-3H2,1H3/t4-,5-,6-/m0/s1 |
| InChIKey | XUWNQKBXQZANBZ-ZLUOBGJFSA-N |
| XLogP | 0.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.07 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|