C21H20F4N4O — CID 170259637
2-[5-fluoro-4-[(1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-5-(trifluoromethyl)phenol (PubChem CID 170259637) has the molecular formula C21H20F4N4O and a molecular weight of 420.41 g/mol. Its IUPAC name is 2-[5-fluoro-4-[(1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-5-(trifluoromethyl)phenol.
| Compound Name | 2-[5-fluoro-4-[(1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 170259637 |
| Molecular Formula | C21H20F4N4O |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 2-[5-fluoro-4-[(1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-5-(trifluoromethyl)phenol |
| SMILES | CN1CCCC(Nc2nnc(-c3ccc(C(F)(F)F)cc3O)c3cccc(F)c23)C1 |
| InChI | InChI=1S/C21H20F4N4O/c1-29-9-3-4-13(11-29)26-20-18-15(5-2-6-16(18)22)19(27-28-20)14-8-7-12(10-17(14)30)21(23,24)25/h2,5-8,10,13,30H,3-4,9,11H2,1H3,(H,26,28) |
| InChIKey | JUFYMXNMHVESFK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |