C19H21F3N6O3 — CID 175599350
formic acid;2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]imidazo[1,5-d][1,2,4]triazin-1-yl]-5-(trifluoromethyl)phenol (PubChem CID 175599350) has the molecular formula C19H21F3N6O3 and a molecular weight of 438.41 g/mol. Its IUPAC name is formic acid;2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]imidazo[1,5-d][1,2,4]triazin-1-yl]-5-(trifluoromethyl)phenol.
| Compound Name | formic acid;2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]imidazo[1,5-d][1,2,4]triazin-1-yl]-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 175599350 |
| Molecular Formula | C19H21F3N6O3 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | formic acid;2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]imidazo[1,5-d][1,2,4]triazin-1-yl]-5-(trifluoromethyl)phenol |
| SMILES | CN1CCC[C@@H](Nc2nnc(-c3ccc(C(F)(F)F)cc3O)c3cncn23)C1.O=CO |
| InChI | InChI=1S/C18H19F3N6O.CH2O2/c1-26-6-2-3-12(9-26)23-17-25-24-16(14-8-22-10-27(14)17)13-5-4-11(7-15(13)28)18(19,20)21;2-1-3/h4-5,7-8,10,12,28H,2-3,6,9H2,1H3,(H,23,25);1H,(H,2,3)/t12-;/m1./s1 |
| InChIKey | SIQMSXPGXUEFKJ-UTONKHPSSA-N |
| XLogP | 2.72 |
| TPSA | 115.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|