C57H44N4 — CID 170259796
9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-[4-(9,9,10,10-tetramethylphenanthren-2-yl)phenyl]carbazole (PubChem CID 170259796) has the molecular formula C57H44N4 and a molecular weight of 785.01 g/mol. Its IUPAC name is 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-[4-(9,9,10,10-tetramethylphenanthren-2-yl)phenyl]carbazole.
| Compound Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-[4-(9,9,10,10-tetramethylphenanthren-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 170259796 |
| Molecular Formula | C57H44N4 |
| Molecular Weight | 785.01 g/mol |
| Exact Mass | 784.36 |
| IUPAC Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-[4-(9,9,10,10-tetramethylphenanthren-2-yl)phenyl]carbazole |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc(-c4ccc5c6ccccc6n(-c6ccc(-c7nc(-c8ccccc8)nc(-c8ccccc8)n7)cc6)c5c4)cc3)cc2C1(C)C |
| InChI | InChI=1S/C57H44N4/c1-56(2)49-21-13-11-19-45(49)46-33-29-42(35-50(46)57(56,3)4)37-23-25-38(26-24-37)43-30-34-48-47-20-12-14-22-51(47)61(52(48)36-43)44-31-27-41(28-32-44)55-59-53(39-15-7-5-8-16-39)58-54(60-55)40-17-9-6-10-18-40/h5-36H,1-4H3 |
| InChIKey | USFCJWMIHKZRQC-UHFFFAOYSA-N |
| XLogP | 14.54 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.01 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |