C57H50N4 — CID 163493829
12,12,13,13-tetramethyl-11-[3-[4-phenyl-6-(9,9,10,10-tetramethylphenanthren-2-yl)-1,3,5-triazin-2-yl]phenyl]naphtho[2,1-a]carbazole (PubChem CID 163493829) has the molecular formula C57H50N4 and a molecular weight of 791.06 g/mol. Its IUPAC name is 12,12,13,13-tetramethyl-11-[3-[4-phenyl-6-(9,9,10,10-tetramethylphenanthren-2-yl)-1,3,5-triazin-2-yl]phenyl]naphtho[2,1-a]carbazole.
| Compound Name | 12,12,13,13-tetramethyl-11-[3-[4-phenyl-6-(9,9,10,10-tetramethylphenanthren-2-yl)-1,3,5-triazin-2-yl]phenyl]naphtho[2,1-a]carbazole |
|---|---|
| PubChem CID | 163493829 |
| Molecular Formula | C57H50N4 |
| Molecular Weight | 791.06 g/mol |
| Exact Mass | 790.40 |
| IUPAC Name | 12,12,13,13-tetramethyl-11-[3-[4-phenyl-6-(9,9,10,10-tetramethylphenanthren-2-yl)-1,3,5-triazin-2-yl]phenyl]naphtho[2,1-a]carbazole |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc(-n5c6ccccc6c6ccc7c(c65)C(C)(C)C(C)(C)c5ccccc5-7)c4)n3)cc2C1(C)C |
| InChI | InChI=1S/C57H50N4/c1-54(2)45-26-15-12-23-39(45)41-30-29-37(34-47(41)56(54,5)6)53-59-51(35-19-10-9-11-20-35)58-52(60-53)36-21-18-22-38(33-36)61-48-28-17-14-25-42(48)44-32-31-43-40-24-13-16-27-46(40)55(3,4)57(7,8)49(43)50(44)61/h9-34H,1-8H3 |
| InChIKey | VKRVZIWEUOZRSY-UHFFFAOYSA-N |
| XLogP | 14.44 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.06 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |