C30H46N4O3 — CID 170260552
N-[1-[[4-[(tert-butylamino)methyl]phenyl]methylamino]-1-oxohexan-2-yl]-4-hydroxy-3,6,6-trimethyl-1,4,5,7-tetrahydroindole-2-carboxamide (PubChem CID 170260552) has the molecular formula C30H46N4O3 and a molecular weight of 510.72 g/mol. Its IUPAC name is N-[1-[[4-[(tert-butylamino)methyl]phenyl]methylamino]-1-oxohexan-2-yl]-4-hydroxy-3,6,6-trimethyl-1,4,5,7-tetrahydroindole-2-carboxamide.
| Compound Name | N-[1-[[4-[(tert-butylamino)methyl]phenyl]methylamino]-1-oxohexan-2-yl]-4-hydroxy-3,6,6-trimethyl-1,4,5,7-tetrahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 170260552 |
| Molecular Formula | C30H46N4O3 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.36 |
| IUPAC Name | N-[1-[[4-[(tert-butylamino)methyl]phenyl]methylamino]-1-oxohexan-2-yl]-4-hydroxy-3,6,6-trimethyl-1,4,5,7-tetrahydroindole-2-carboxamide |
| SMILES | CCCCC(NC(=O)c1[nH]c2c(c1C)C(O)CC(C)(C)C2)C(=O)NCc1ccc(CNC(C)(C)C)cc1 |
| InChI | InChI=1S/C30H46N4O3/c1-8-9-10-22(27(36)31-17-20-11-13-21(14-12-20)18-32-29(3,4)5)34-28(37)26-19(2)25-23(33-26)15-30(6,7)16-24(25)35/h11-14,22,24,32-33,35H,8-10,15-18H2,1-7H3,(H,31,36)(H,34,37) |
| InChIKey | JDRBBABOPHXHEC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |