C25H32F3N3O3 — CID 170260241
4-hydroxy-3,6,6-trimethyl-N-[1-oxo-1-[2-(trifluoromethyl)anilino]hexan-2-yl]-1,4,5,7-tetrahydroindole-2-carboxamide (PubChem CID 170260241) has the molecular formula C25H32F3N3O3 and a molecular weight of 479.54 g/mol. Its IUPAC name is 4-hydroxy-3,6,6-trimethyl-N-[1-oxo-1-[2-(trifluoromethyl)anilino]hexan-2-yl]-1,4,5,7-tetrahydroindole-2-carboxamide.
| Compound Name | 4-hydroxy-3,6,6-trimethyl-N-[1-oxo-1-[2-(trifluoromethyl)anilino]hexan-2-yl]-1,4,5,7-tetrahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 170260241 |
| Molecular Formula | C25H32F3N3O3 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 4-hydroxy-3,6,6-trimethyl-N-[1-oxo-1-[2-(trifluoromethyl)anilino]hexan-2-yl]-1,4,5,7-tetrahydroindole-2-carboxamide |
| SMILES | CCCCC(NC(=O)c1[nH]c2c(c1C)C(O)CC(C)(C)C2)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C25H32F3N3O3/c1-5-6-10-17(22(33)30-16-11-8-7-9-15(16)25(26,27)28)31-23(34)21-14(2)20-18(29-21)12-24(3,4)13-19(20)32/h7-9,11,17,19,29,32H,5-6,10,12-13H2,1-4H3,(H,30,33)(H,31,34) |
| InChIKey | ODKSAHDPLUSGQP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |