C31H43N5O4 — CID 170260806
3,6,6-trimethyl-N-[1-[6-(3-morpholin-4-ylpropoxy)-1H-benzimidazol-2-yl]pentyl]-4-oxo-5,7-dihydro-1H-indole-2-carboxamide (PubChem CID 170260806) has the molecular formula C31H43N5O4 and a molecular weight of 549.72 g/mol. Its IUPAC name is 3,6,6-trimethyl-N-[1-[6-(3-morpholin-4-ylpropoxy)-1H-benzimidazol-2-yl]pentyl]-4-oxo-5,7-dihydro-1H-indole-2-carboxamide.
| Compound Name | 3,6,6-trimethyl-N-[1-[6-(3-morpholin-4-ylpropoxy)-1H-benzimidazol-2-yl]pentyl]-4-oxo-5,7-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 170260806 |
| Molecular Formula | C31H43N5O4 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.33 |
| IUPAC Name | 3,6,6-trimethyl-N-[1-[6-(3-morpholin-4-ylpropoxy)-1H-benzimidazol-2-yl]pentyl]-4-oxo-5,7-dihydro-1H-indole-2-carboxamide |
| SMILES | CCCCC(NC(=O)c1[nH]c2c(c1C)C(=O)CC(C)(C)C2)c1nc2ccc(OCCCN3CCOCC3)cc2[nH]1 |
| InChI | InChI=1S/C31H43N5O4/c1-5-6-8-23(35-30(38)28-20(2)27-25(32-28)18-31(3,4)19-26(27)37)29-33-22-10-9-21(17-24(22)34-29)40-14-7-11-36-12-15-39-16-13-36/h9-10,17,23,32H,5-8,11-16,18-19H2,1-4H3,(H,33,34)(H,35,38) |
| InChIKey | RRCJRDQLXQFXOP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 112.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|