C15H23NO3 — CID 170263875
2-[4-hydroxy-2-methyl-4-(methylamino)butan-2-yl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 170263875) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 2-[4-hydroxy-2-methyl-4-(methylamino)butan-2-yl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[4-hydroxy-2-methyl-4-(methylamino)butan-2-yl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 170263875 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 2-[4-hydroxy-2-methyl-4-(methylamino)butan-2-yl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CNC(O)CC(C)(C)C1=C(C)C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C15H23NO3/c1-8-9(2)14(19)12(10(3)13(8)18)15(4,5)7-11(17)16-6/h11,16-17H,7H2,1-6H3 |
| InChIKey | BOWDVEOQCWVTSC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|