C32H43N5O5 — CID 170264280
N-[(2S)-1-[[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-4-[(3R)-2-oxopyrrolidin-3-yl]butan-2-yl]amino]propan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]quinoline-2-carboxamide (PubChem CID 170264280) has the molecular formula C32H43N5O5 and a molecular weight of 577.73 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-4-[(3R)-2-oxopyrrolidin-3-yl]butan-2-yl]amino]propan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]quinoline-2-carboxamide.
| Compound Name | N-[(2S)-1-[[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-4-[(3R)-2-oxopyrrolidin-3-yl]butan-2-yl]amino]propan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 170264280 |
| Molecular Formula | C32H43N5O5 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.33 |
| IUPAC Name | N-[(2S)-1-[[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-4-[(3R)-2-oxopyrrolidin-3-yl]butan-2-yl]amino]propan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]quinoline-2-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccc2ccccc2n1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)CC[C@@H]1CCNC1=O |
| InChI | InChI=1S/C32H43N5O5/c1-20(2)28(37-30(40)26-15-13-22-10-6-7-11-25(22)35-26)32(42)36-27(18-21-8-4-3-5-9-21)31(41)34-24(19-38)14-12-23-16-17-33-29(23)39/h6-7,10-11,13,15,19-21,23-24,27-28H,3-5,8-9,12,14,16-18H2,1-2H3,(H,33,39)(H,34,41)(H,36,42)(H,37,40)/t23-,24+,27+,28+/m1/s1 |
| InChIKey | ZBECLESGHIITGD-JGPKDBRGSA-N |
| XLogP | 3.04 |
| TPSA | 146.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|