C17H11F4IN2O — CID 170266065
3-(2,2-difluorocyclopropyl)-6-[4-[difluoro(iodo)methoxy]phenyl]imidazo[1,5-a]pyridine (PubChem CID 170266065) has the molecular formula C17H11F4IN2O and a molecular weight of 462.18 g/mol. Its IUPAC name is 3-(2,2-difluorocyclopropyl)-6-[4-[difluoro(iodo)methoxy]phenyl]imidazo[1,5-a]pyridine.
| Compound Name | 3-(2,2-difluorocyclopropyl)-6-[4-[difluoro(iodo)methoxy]phenyl]imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 170266065 |
| Molecular Formula | C17H11F4IN2O |
| Molecular Weight | 462.18 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | 3-(2,2-difluorocyclopropyl)-6-[4-[difluoro(iodo)methoxy]phenyl]imidazo[1,5-a]pyridine |
| SMILES | FC(F)(I)Oc1ccc(-c2ccc3cnc(C4CC4(F)F)n3c2)cc1 |
| InChI | InChI=1S/C17H11F4IN2O/c18-16(19)7-14(16)15-23-8-12-4-1-11(9-24(12)15)10-2-5-13(6-3-10)25-17(20,21)22/h1-6,8-9,14H,7H2 |
| InChIKey | GTBRCMSZCGREBI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.18 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|