About 3-(2,2-difluorocyclopropyl)-6-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyridine
3-(2,2-difluorocyclopropyl)-6-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyridine (PubChem CID 134560300) has the molecular formula C17H11F5N2O
and a molecular weight of 354.28 g/mol. Its IUPAC name is 3-(2,2-difluorocyclopropyl)-6-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 3-(2,2-difluorocyclopropyl)-6-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyridine |
| PubChem CID | 134560300 |
| Molecular Formula | C17H11F5N2O |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 3-(2,2-difluorocyclopropyl)-6-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyridine |
| SMILES | FC(F)(F)Oc1ccc(-c2ccc3cnc(C4CC4(F)F)n3c2)cc1 |
| InChI | InChI=1S/C17H11F5N2O/c18-16(19)7-14(16)15-23-8-12-4-1-11(9-24(12)15)10-2-5-13(6-3-10)25-17(20,21)22/h1-6,8-9,14H,7H2 |
| InChIKey | JJUWVXYAFZXWNR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,2-difluorocyclopropyl)-6-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluorocyclopropyl)-6-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyridine?
The IUPAC name of 3-(2,2-difluorocyclopropyl)-6-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyridine (CID 134560300) is 3-(2,2-difluorocyclopropyl)-6-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyridine.
What is the SMILES notation for 3-(2,2-difluorocyclopropyl)-6-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyridine?
The canonical SMILES for 3-(2,2-difluorocyclopropyl)-6-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyridine is FC(F)(F)Oc1ccc(-c2ccc3cnc(C4CC4(F)F)n3c2)cc1.
What is the InChIKey of 3-(2,2-difluorocyclopropyl)-6-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyridine?
The InChIKey is JJUWVXYAFZXWNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F5N2O/c18-16(19)7-14(16)15-23-8-12-4-1-11(9-24(12)15)10-2-5-13(6-3-10)25-17(20,21)22/h1-6,8-9,14H,7H2.
What are the key properties of 3-(2,2-difluorocyclopropyl)-6-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyridine?
3-(2,2-difluorocyclopropyl)-6-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyridine has a molecular weight of 354.28 g/mol, XLogP of 5.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluorocyclopropyl)-6-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyridine is sourced from PubChem (CID 134560300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).