C24H21F2N7O — CID 170269973
(2Z,4E)-4-[5-[[[3-(3,5-difluorophenyl)imidazo[1,2-a]pyrazin-8-yl]amino]methyl]pyrazin-2-yl]-5-(dimethylamino)penta-2,4-dienal (PubChem CID 170269973) has the molecular formula C24H21F2N7O and a molecular weight of 461.48 g/mol. Its IUPAC name is (2Z,4E)-4-[5-[[[3-(3,5-difluorophenyl)imidazo[1,2-a]pyrazin-8-yl]amino]methyl]pyrazin-2-yl]-5-(dimethylamino)penta-2,4-dienal.
| Compound Name | (2Z,4E)-4-[5-[[[3-(3,5-difluorophenyl)imidazo[1,2-a]pyrazin-8-yl]amino]methyl]pyrazin-2-yl]-5-(dimethylamino)penta-2,4-dienal |
|---|---|
| PubChem CID | 170269973 |
| Molecular Formula | C24H21F2N7O |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | (2Z,4E)-4-[5-[[[3-(3,5-difluorophenyl)imidazo[1,2-a]pyrazin-8-yl]amino]methyl]pyrazin-2-yl]-5-(dimethylamino)penta-2,4-dienal |
| SMILES | CN(C)/C=C(\C=C/C=O)c1cnc(CNc2nccn3c(-c4cc(F)cc(F)c4)cnc23)cn1 |
| InChI | InChI=1S/C24H21F2N7O/c1-32(2)15-16(4-3-7-34)21-13-28-20(11-29-21)12-30-23-24-31-14-22(33(24)6-5-27-23)17-8-18(25)10-19(26)9-17/h3-11,13-15H,12H2,1-2H3,(H,27,30)/b4-3-,16-15+ |
| InChIKey | DYKIOBHOFMZRRQ-MLOLRHNGSA-N |
| XLogP | 3.73 |
| TPSA | 88.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|