C26H20F3N3O5S — CID 170271431
3-[4-[1,6-dimethyl-2-oxo-4-(trifluoromethyl)-3-pyridinyl]phenyl]-2-[(3-sulfinylindole-2-carbonyl)amino]propanoic acid (PubChem CID 170271431) has the molecular formula C26H20F3N3O5S and a molecular weight of 543.52 g/mol. Its IUPAC name is 3-[4-[1,6-dimethyl-2-oxo-4-(trifluoromethyl)-3-pyridinyl]phenyl]-2-[(3-sulfinylindole-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-[4-[1,6-dimethyl-2-oxo-4-(trifluoromethyl)-3-pyridinyl]phenyl]-2-[(3-sulfinylindole-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 170271431 |
| Molecular Formula | C26H20F3N3O5S |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 3-[4-[1,6-dimethyl-2-oxo-4-(trifluoromethyl)-3-pyridinyl]phenyl]-2-[(3-sulfinylindole-2-carbonyl)amino]propanoic acid |
| SMILES | Cc1cc(C(F)(F)F)c(-c2ccc(CC(NC(=O)C3=Nc4ccccc4C3=S=O)C(=O)O)cc2)c(=O)n1C |
| InChI | InChI=1S/C26H20F3N3O5S/c1-13-11-17(26(27,28)29)20(24(34)32(13)2)15-9-7-14(8-10-15)12-19(25(35)36)31-23(33)21-22(38-37)16-5-3-4-6-18(16)30-21/h3-11,19H,12H2,1-2H3,(H,31,33)(H,35,36) |
| InChIKey | OITYVKWEPPGMAJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 117.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|