C19H17N2+ — CID 170272131
1,9-dimethyl-2-phenylpyrido[2,3-b]indol-1-ium (PubChem CID 170272131) has the molecular formula C19H17N2+ and a molecular weight of 273.36 g/mol. Its IUPAC name is 1,9-dimethyl-2-phenylpyrido[2,3-b]indol-1-ium.
| Compound Name | 1,9-dimethyl-2-phenylpyrido[2,3-b]indol-1-ium |
|---|---|
| PubChem CID | 170272131 |
| Molecular Formula | C19H17N2+ |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 1,9-dimethyl-2-phenylpyrido[2,3-b]indol-1-ium |
| SMILES | Cn1c2ccccc2c2ccc(-c3ccccc3)[n+](C)c21 |
| InChI | InChI=1S/C19H17N2/c1-20-17(14-8-4-3-5-9-14)13-12-16-15-10-6-7-11-18(15)21(2)19(16)20/h3-13H,1-2H3/q+1 |
| InChIKey | QWYFICAFJZFABH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|