C10H19Cl — CID 170272561
1-chloro-3-ethyl-2,5-dimethylcyclohexane (PubChem CID 170272561) has the molecular formula C10H19Cl and a molecular weight of 174.71 g/mol. Its IUPAC name is 1-chloro-3-ethyl-2,5-dimethylcyclohexane.
| Compound Name | 1-chloro-3-ethyl-2,5-dimethylcyclohexane |
|---|---|
| PubChem CID | 170272561 |
| Molecular Formula | C10H19Cl |
| Molecular Weight | 174.71 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1-chloro-3-ethyl-2,5-dimethylcyclohexane |
| SMILES | CCC1CC(C)CC(Cl)C1C |
| InChI | InChI=1S/C10H19Cl/c1-4-9-5-7(2)6-10(11)8(9)3/h7-10H,4-6H2,1-3H3 |
| InChIKey | RHRUYKQOTDSNJB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.71 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|