C49H34O6 — CID 170277764
3,6-bis(4-hydroxyphenyl)-5-(2-methyl-10-naphtho[2,3-b][1]benzofuran-1-yl-1,2-dihydroanthracen-9-yl)benzene-1,2,4-triol (PubChem CID 170277764) has the molecular formula C49H34O6 and a molecular weight of 718.81 g/mol. Its IUPAC name is 3,6-bis(4-hydroxyphenyl)-5-(2-methyl-10-naphtho[2,3-b][1]benzofuran-1-yl-1,2-dihydroanthracen-9-yl)benzene-1,2,4-triol.
| Compound Name | 3,6-bis(4-hydroxyphenyl)-5-(2-methyl-10-naphtho[2,3-b][1]benzofuran-1-yl-1,2-dihydroanthracen-9-yl)benzene-1,2,4-triol |
|---|---|
| PubChem CID | 170277764 |
| Molecular Formula | C49H34O6 |
| Molecular Weight | 718.81 g/mol |
| Exact Mass | 718.24 |
| IUPAC Name | 3,6-bis(4-hydroxyphenyl)-5-(2-methyl-10-naphtho[2,3-b][1]benzofuran-1-yl-1,2-dihydroanthracen-9-yl)benzene-1,2,4-triol |
| SMILES | CC1C=Cc2c(c(-c3c(O)c(-c4ccc(O)cc4)c(O)c(O)c3-c3ccc(O)cc3)c3ccccc3c2-c2cccc3oc4cc5ccccc5cc4c23)C1 |
| InChI | InChI=1S/C49H34O6/c1-26-13-22-35-37(23-26)45(46-41(27-14-18-31(50)19-15-27)48(53)49(54)42(47(46)52)28-16-20-32(51)21-17-28)34-10-5-4-9-33(34)43(35)36-11-6-12-39-44(36)38-24-29-7-2-3-8-30(29)25-40(38)55-39/h2-22,24-26,50-54H,23H2,1H3 |
| InChIKey | PEWRWGLZKQTXIW-UHFFFAOYSA-N |
| XLogP | 12.29 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.81 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|