C14H11FN4O — CID 170279897
4-(4-fluoro-2-methoxyphenyl)pyrido[3,4-d]pyridazin-1-amine (PubChem CID 170279897) has the molecular formula C14H11FN4O and a molecular weight of 270.27 g/mol. Its IUPAC name is 4-(4-fluoro-2-methoxyphenyl)pyrido[3,4-d]pyridazin-1-amine.
| Compound Name | 4-(4-fluoro-2-methoxyphenyl)pyrido[3,4-d]pyridazin-1-amine |
|---|---|
| PubChem CID | 170279897 |
| Molecular Formula | C14H11FN4O |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-(4-fluoro-2-methoxyphenyl)pyrido[3,4-d]pyridazin-1-amine |
| SMILES | COc1cc(F)ccc1-c1nnc(N)c2ccncc12 |
| InChI | InChI=1S/C14H11FN4O/c1-20-12-6-8(15)2-3-10(12)13-11-7-17-5-4-9(11)14(16)19-18-13/h2-7H,1H3,(H2,16,19) |
| InChIKey | ACPHGZMVPAWPKU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |