About 1-[2-[(4-methoxyphenyl)methoxy]-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-amine
1-[2-[(4-methoxyphenyl)methoxy]-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-amine (PubChem CID 166456018) has the molecular formula C22H17F3N4O2
and a molecular weight of 426.40 g/mol. Its IUPAC name is 1-[2-[(4-methoxyphenyl)methoxy]-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-amine.
Molecular Properties
| Compound Name | 1-[2-[(4-methoxyphenyl)methoxy]-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-amine |
| PubChem CID | 166456018 |
| Molecular Formula | C22H17F3N4O2 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 1-[2-[(4-methoxyphenyl)methoxy]-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-amine |
| SMILES | COc1ccc(COc2cc(C(F)(F)F)ccc2-c2nnc(N)c3cnccc23)cc1 |
| InChI | InChI=1S/C22H17F3N4O2/c1-30-15-5-2-13(3-6-15)12-31-19-10-14(22(23,24)25)4-7-17(19)20-16-8-9-27-11-18(16)21(26)29-28-20/h2-11H,12H2,1H3,(H2,26,29) |
| InChIKey | RRHRWMMGDDSTKV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-[(4-methoxyphenyl)methoxy]-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(4-methoxyphenyl)methoxy]-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-amine?
The IUPAC name of 1-[2-[(4-methoxyphenyl)methoxy]-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-amine (CID 166456018) is 1-[2-[(4-methoxyphenyl)methoxy]-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-amine.
What is the SMILES notation for 1-[2-[(4-methoxyphenyl)methoxy]-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-amine?
The canonical SMILES for 1-[2-[(4-methoxyphenyl)methoxy]-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-amine is COc1ccc(COc2cc(C(F)(F)F)ccc2-c2nnc(N)c3cnccc23)cc1.
What is the InChIKey of 1-[2-[(4-methoxyphenyl)methoxy]-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-amine?
The InChIKey is RRHRWMMGDDSTKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17F3N4O2/c1-30-15-5-2-13(3-6-15)12-31-19-10-14(22(23,24)25)4-7-17(19)20-16-8-9-27-11-18(16)21(26)29-28-20/h2-11H,12H2,1H3,(H2,26,29).
What are the key properties of 1-[2-[(4-methoxyphenyl)methoxy]-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-amine?
1-[2-[(4-methoxyphenyl)methoxy]-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-amine has a molecular weight of 426.40 g/mol, XLogP of 4.88, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(4-methoxyphenyl)methoxy]-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-amine is sourced from PubChem (CID 166456018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).