C30H34ClFN4O3 — CID 170280374
N-[2-[5-chloro-6-(5-fluoro-2-hydroxyphenyl)-2-(N-formyl-2-propan-2-ylanilino)-3-pyridinyl]propyl]-N-[2-(methylamino)ethyl]prop-2-enamide (PubChem CID 170280374) has the molecular formula C30H34ClFN4O3 and a molecular weight of 553.08 g/mol. Its IUPAC name is N-[2-[5-chloro-6-(5-fluoro-2-hydroxyphenyl)-2-(N-formyl-2-propan-2-ylanilino)-3-pyridinyl]propyl]-N-[2-(methylamino)ethyl]prop-2-enamide.
| Compound Name | N-[2-[5-chloro-6-(5-fluoro-2-hydroxyphenyl)-2-(N-formyl-2-propan-2-ylanilino)-3-pyridinyl]propyl]-N-[2-(methylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 170280374 |
| Molecular Formula | C30H34ClFN4O3 |
| Molecular Weight | 553.08 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | N-[2-[5-chloro-6-(5-fluoro-2-hydroxyphenyl)-2-(N-formyl-2-propan-2-ylanilino)-3-pyridinyl]propyl]-N-[2-(methylamino)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CCNC)CC(C)c1cc(Cl)c(-c2cc(F)ccc2O)nc1N(C=O)c1ccccc1C(C)C |
| InChI | InChI=1S/C30H34ClFN4O3/c1-6-28(39)35(14-13-33-5)17-20(4)23-16-25(31)29(24-15-21(32)11-12-27(24)38)34-30(23)36(18-37)26-10-8-7-9-22(26)19(2)3/h6-12,15-16,18-20,33,38H,1,13-14,17H2,2-5H3 |
| InChIKey | HMXVGDWNVLKJMB-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.08 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|