C22H26N2O3S — CID 17028039
propan-2-yl 2-[2-[2-(2,4-dimethylphenoxy)ethylsulfanyl]benzimidazol-1-yl]acetate (PubChem CID 17028039) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is propan-2-yl 2-[2-[2-(2,4-dimethylphenoxy)ethylsulfanyl]benzimidazol-1-yl]acetate.
| Compound Name | propan-2-yl 2-[2-[2-(2,4-dimethylphenoxy)ethylsulfanyl]benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 17028039 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | propan-2-yl 2-[2-[2-(2,4-dimethylphenoxy)ethylsulfanyl]benzimidazol-1-yl]acetate |
| SMILES | Cc1ccc(OCCSc2nc3ccccc3n2CC(=O)OC(C)C)c(C)c1 |
| InChI | InChI=1S/C22H26N2O3S/c1-15(2)27-21(25)14-24-19-8-6-5-7-18(19)23-22(24)28-12-11-26-20-10-9-16(3)13-17(20)4/h5-10,13,15H,11-12,14H2,1-4H3 |
| InChIKey | STIFPEILZILGIV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|