C27H36FNO5 — CID 170280850
4-[4-(2-fluoro-3-methoxy-4,5-dimethylphenyl)-3-(3-methylbutoxymethyl)anilino]oxane-4-carboxylic acid (PubChem CID 170280850) has the molecular formula C27H36FNO5 and a molecular weight of 473.59 g/mol. Its IUPAC name is 4-[4-(2-fluoro-3-methoxy-4,5-dimethylphenyl)-3-(3-methylbutoxymethyl)anilino]oxane-4-carboxylic acid.
| Compound Name | 4-[4-(2-fluoro-3-methoxy-4,5-dimethylphenyl)-3-(3-methylbutoxymethyl)anilino]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 170280850 |
| Molecular Formula | C27H36FNO5 |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | 4-[4-(2-fluoro-3-methoxy-4,5-dimethylphenyl)-3-(3-methylbutoxymethyl)anilino]oxane-4-carboxylic acid |
| SMILES | COc1c(C)c(C)cc(-c2ccc(NC3(C(=O)O)CCOCC3)cc2COCCC(C)C)c1F |
| InChI | InChI=1S/C27H36FNO5/c1-17(2)8-11-34-16-20-15-21(29-27(26(30)31)9-12-33-13-10-27)6-7-22(20)23-14-18(3)19(4)25(32-5)24(23)28/h6-7,14-15,17,29H,8-13,16H2,1-5H3,(H,30,31) |
| InChIKey | DJCZJNQCLWDVJH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|