C25H32FNO5 — CID 170285656
1-[3-(butoxymethyl)-4-(3-ethoxy-2-fluoro-5-methoxyphenyl)anilino]cyclobutane-1-carboxylic acid (PubChem CID 170285656) has the molecular formula C25H32FNO5 and a molecular weight of 445.53 g/mol. Its IUPAC name is 1-[3-(butoxymethyl)-4-(3-ethoxy-2-fluoro-5-methoxyphenyl)anilino]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[3-(butoxymethyl)-4-(3-ethoxy-2-fluoro-5-methoxyphenyl)anilino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 170285656 |
| Molecular Formula | C25H32FNO5 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 1-[3-(butoxymethyl)-4-(3-ethoxy-2-fluoro-5-methoxyphenyl)anilino]cyclobutane-1-carboxylic acid |
| SMILES | CCCCOCc1cc(NC2(C(=O)O)CCC2)ccc1-c1cc(OC)cc(OCC)c1F |
| InChI | InChI=1S/C25H32FNO5/c1-4-6-12-31-16-17-13-18(27-25(24(28)29)10-7-11-25)8-9-20(17)21-14-19(30-3)15-22(23(21)26)32-5-2/h8-9,13-15,27H,4-7,10-12,16H2,1-3H3,(H,28,29) |
| InChIKey | HZPPUAFOPHOAEQ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|