C27H23N3O5 — CID 170282116
10-(3-aminophenyl)-7-ethoxy-19-hydroxy-6-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione (PubChem CID 170282116) has the molecular formula C27H23N3O5 and a molecular weight of 469.50 g/mol. Its IUPAC name is 10-(3-aminophenyl)-7-ethoxy-19-hydroxy-6-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione.
| Compound Name | 10-(3-aminophenyl)-7-ethoxy-19-hydroxy-6-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 170282116 |
| Molecular Formula | C27H23N3O5 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 10-(3-aminophenyl)-7-ethoxy-19-hydroxy-6-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| SMILES | CCOc1cc2c(-c3cccc(N)c3)c3c(nc2cc1C)-c1cc2c(c(=O)n1C3)COC(=O)C2O |
| InChI | InChI=1S/C27H23N3O5/c1-3-34-22-10-17-20(7-13(22)2)29-24-18(23(17)14-5-4-6-15(28)8-14)11-30-21(24)9-16-19(26(30)32)12-35-27(33)25(16)31/h4-10,25,31H,3,11-12,28H2,1-2H3 |
| InChIKey | ZLKIDKGGICQPMT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|