C33H33N3O2S — CID 170288533
N-[2-(benzylcarbamothioyl)-3,4-dihydro-1H-isoquinolin-6-yl]-2-(4-ethylphenyl)-3-methoxybenzamide (PubChem CID 170288533) has the molecular formula C33H33N3O2S and a molecular weight of 535.71 g/mol. Its IUPAC name is N-[2-(benzylcarbamothioyl)-3,4-dihydro-1H-isoquinolin-6-yl]-2-(4-ethylphenyl)-3-methoxybenzamide.
| Compound Name | N-[2-(benzylcarbamothioyl)-3,4-dihydro-1H-isoquinolin-6-yl]-2-(4-ethylphenyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 170288533 |
| Molecular Formula | C33H33N3O2S |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | N-[2-(benzylcarbamothioyl)-3,4-dihydro-1H-isoquinolin-6-yl]-2-(4-ethylphenyl)-3-methoxybenzamide |
| SMILES | CCc1ccc(-c2c(OC)cccc2C(=O)Nc2ccc3c(c2)CCN(C(=S)NCc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C33H33N3O2S/c1-3-23-12-14-25(15-13-23)31-29(10-7-11-30(31)38-2)32(37)35-28-17-16-27-22-36(19-18-26(27)20-28)33(39)34-21-24-8-5-4-6-9-24/h4-17,20H,3,18-19,21-22H2,1-2H3,(H,34,39)(H,35,37) |
| InChIKey | PUKWWLOFFPVNRD-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|