C28H18I2S2 — CID 170289466
[4-[4-[6-(4-iodosulfanylphenyl)naphthalen-2-yl]phenyl]phenyl] thiohypoiodite (PubChem CID 170289466) has the molecular formula C28H18I2S2 and a molecular weight of 672.39 g/mol. Its IUPAC name is [4-[4-[6-(4-iodosulfanylphenyl)naphthalen-2-yl]phenyl]phenyl] thiohypoiodite.
| Compound Name | [4-[4-[6-(4-iodosulfanylphenyl)naphthalen-2-yl]phenyl]phenyl] thiohypoiodite |
|---|---|
| PubChem CID | 170289466 |
| Molecular Formula | C28H18I2S2 |
| Molecular Weight | 672.39 g/mol |
| Exact Mass | 671.89 |
| IUPAC Name | [4-[4-[6-(4-iodosulfanylphenyl)naphthalen-2-yl]phenyl]phenyl] thiohypoiodite |
| SMILES | ISc1ccc(-c2ccc(-c3ccc4cc(-c5ccc(SI)cc5)ccc4c3)cc2)cc1 |
| InChI | InChI=1S/C28H18I2S2/c29-31-27-13-9-20(10-14-27)19-1-3-21(4-2-19)23-5-7-26-18-24(6-8-25(26)17-23)22-11-15-28(32-30)16-12-22/h1-18H |
| InChIKey | APKWMDRKHJFQET-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.39 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|