C12H13ClINO2 — CID 170290015
(2R,3R,6S)-2-amino-2-(2-chlorophenyl)-6-hydroxy-3-iodocyclohexan-1-one (PubChem CID 170290015) has the molecular formula C12H13ClINO2 and a molecular weight of 365.60 g/mol. Its IUPAC name is (2R,3R,6S)-2-amino-2-(2-chlorophenyl)-6-hydroxy-3-iodocyclohexan-1-one.
| Compound Name | (2R,3R,6S)-2-amino-2-(2-chlorophenyl)-6-hydroxy-3-iodocyclohexan-1-one |
|---|---|
| PubChem CID | 170290015 |
| Molecular Formula | C12H13ClINO2 |
| Molecular Weight | 365.60 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | (2R,3R,6S)-2-amino-2-(2-chlorophenyl)-6-hydroxy-3-iodocyclohexan-1-one |
| SMILES | N[C@]1(c2ccccc2Cl)C(=O)[C@@H](O)CC[C@H]1I |
| InChI | InChI=1S/C12H13ClINO2/c13-8-4-2-1-3-7(8)12(15)10(14)6-5-9(16)11(12)17/h1-4,9-10,16H,5-6,15H2/t9-,10+,12-/m0/s1 |
| InChIKey | LYVJPIMYWXLYDJ-UMNHJUIQSA-N |
| XLogP | 2.02 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.60 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|