C25H26N3O4P — CID 170290267
(10S,23S)-10-ethyl-10-hydroxy-19-methyl-23-(methylamino)-18-phosphanyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione (PubChem CID 170290267) has the molecular formula C25H26N3O4P and a molecular weight of 463.47 g/mol. Its IUPAC name is (10S,23S)-10-ethyl-10-hydroxy-19-methyl-23-(methylamino)-18-phosphanyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione.
| Compound Name | (10S,23S)-10-ethyl-10-hydroxy-19-methyl-23-(methylamino)-18-phosphanyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione |
|---|---|
| PubChem CID | 170290267 |
| Molecular Formula | C25H26N3O4P |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (10S,23S)-10-ethyl-10-hydroxy-19-methyl-23-(methylamino)-18-phosphanyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(P)c(C)c3c1c2[C@@H](NC)CC3 |
| InChI | InChI=1S/C25H26N3O4P/c1-4-25(31)15-7-18-22-13(9-28(18)23(29)14(15)10-32-24(25)30)21-16(26-3)6-5-12-11(2)19(33)8-17(27-22)20(12)21/h7-8,16,26,31H,4-6,9-10,33H2,1-3H3/t16-,25-/m0/s1 |
| InChIKey | TWAUAJLTZMXNEE-LMKMVOKYSA-N |
| XLogP | 2.10 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|