C21H30N4O3 — CID 17029158
N-[[1-[2-(3-methoxypropylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]cyclohexanecarboxamide (PubChem CID 17029158) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-[[1-[2-(3-methoxypropylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]cyclohexanecarboxamide.
| Compound Name | N-[[1-[2-(3-methoxypropylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 17029158 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | N-[[1-[2-(3-methoxypropylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]cyclohexanecarboxamide |
| SMILES | COCCCNC(=O)Cn1c(CNC(=O)C2CCCCC2)nc2ccccc21 |
| InChI | InChI=1S/C21H30N4O3/c1-28-13-7-12-22-20(26)15-25-18-11-6-5-10-17(18)24-19(25)14-23-21(27)16-8-3-2-4-9-16/h5-6,10-11,16H,2-4,7-9,12-15H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | KQNGGLQBNHMRSC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|