C24H32INO — CID 170294080
(2R)-1-[[2-[(3-iodophenyl)methoxy]-5-methyl-4-propan-2-ylphenyl]methyl]-2-methylpiperidine (PubChem CID 170294080) has the molecular formula C24H32INO and a molecular weight of 477.43 g/mol. Its IUPAC name is (2R)-1-[[2-[(3-iodophenyl)methoxy]-5-methyl-4-propan-2-ylphenyl]methyl]-2-methylpiperidine.
| Compound Name | (2R)-1-[[2-[(3-iodophenyl)methoxy]-5-methyl-4-propan-2-ylphenyl]methyl]-2-methylpiperidine |
|---|---|
| PubChem CID | 170294080 |
| Molecular Formula | C24H32INO |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | (2R)-1-[[2-[(3-iodophenyl)methoxy]-5-methyl-4-propan-2-ylphenyl]methyl]-2-methylpiperidine |
| SMILES | Cc1cc(CN2CCCC[C@H]2C)c(OCc2cccc(I)c2)cc1C(C)C |
| InChI | InChI=1S/C24H32INO/c1-17(2)23-14-24(27-16-20-9-7-10-22(25)13-20)21(12-18(23)3)15-26-11-6-5-8-19(26)4/h7,9-10,12-14,17,19H,5-6,8,11,15-16H2,1-4H3/t19-/m1/s1 |
| InChIKey | JWRIXCWIAMPDKZ-LJQANCHMSA-N |
| XLogP | 6.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|