C28H22FN3O4S — CID 170295525
5-[8-ethynyl-2-methyl-5-(oxan-4-yl)-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]pyridine-3-sulfonyl fluoride (PubChem CID 170295525) has the molecular formula C28H22FN3O4S and a molecular weight of 515.57 g/mol. Its IUPAC name is 5-[8-ethynyl-2-methyl-5-(oxan-4-yl)-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]pyridine-3-sulfonyl fluoride.
| Compound Name | 5-[8-ethynyl-2-methyl-5-(oxan-4-yl)-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]pyridine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 170295525 |
| Molecular Formula | C28H22FN3O4S |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 5-[8-ethynyl-2-methyl-5-(oxan-4-yl)-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]pyridine-3-sulfonyl fluoride |
| SMILES | C#Cc1ccc2c(c1)[nH]c1c2c(=O)c2cc(C)c(-c3cncc(S(=O)(=O)F)c3)cc2n1C1CCOCC1 |
| InChI | InChI=1S/C28H22FN3O4S/c1-3-17-4-5-21-24(11-17)31-28-26(21)27(33)23-10-16(2)22(18-12-20(15-30-14-18)37(29,34)35)13-25(23)32(28)19-6-8-36-9-7-19/h1,4-5,10-15,19,31H,6-9H2,2H3 |
| InChIKey | UMHHCRKRKUMVAM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|