C31H28FN3O5S — CID 170295704
8-ethynyl-3-(5-fluorosulfonyloxy-3-pyridinyl)-2-(2-methylpropyl)-5-(oxan-4-yl)-11-oxo-6H-indolo[2,3-b]quinoline (PubChem CID 170295704) has the molecular formula C31H28FN3O5S and a molecular weight of 573.65 g/mol. Its IUPAC name is 8-ethynyl-3-(5-fluorosulfonyloxy-3-pyridinyl)-2-(2-methylpropyl)-5-(oxan-4-yl)-11-oxo-6H-indolo[2,3-b]quinoline.
| Compound Name | 8-ethynyl-3-(5-fluorosulfonyloxy-3-pyridinyl)-2-(2-methylpropyl)-5-(oxan-4-yl)-11-oxo-6H-indolo[2,3-b]quinoline |
|---|---|
| PubChem CID | 170295704 |
| Molecular Formula | C31H28FN3O5S |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | 8-ethynyl-3-(5-fluorosulfonyloxy-3-pyridinyl)-2-(2-methylpropyl)-5-(oxan-4-yl)-11-oxo-6H-indolo[2,3-b]quinoline |
| SMILES | C#Cc1ccc2c(c1)[nH]c1c2c(=O)c2cc(CC(C)C)c(-c3cncc(OS(=O)(=O)F)c3)cc2n1C1CCOCC1 |
| InChI | InChI=1S/C31H28FN3O5S/c1-4-19-5-6-24-27(12-19)34-31-29(24)30(36)26-14-20(11-18(2)3)25(15-28(26)35(31)22-7-9-39-10-8-22)21-13-23(17-33-16-21)40-41(32,37)38/h1,5-6,12-18,22,34H,7-11H2,2-3H3 |
| InChIKey | RZJFVJJEDMPVOJ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|