C30H26FN3O5S — CID 170295629
5-cyclohexyl-2-ethoxy-8-ethynyl-3-(5-fluorosulfonyloxy-3-pyridinyl)-11-oxo-6H-indolo[2,3-b]quinoline (PubChem CID 170295629) has the molecular formula C30H26FN3O5S and a molecular weight of 559.62 g/mol. Its IUPAC name is 5-cyclohexyl-2-ethoxy-8-ethynyl-3-(5-fluorosulfonyloxy-3-pyridinyl)-11-oxo-6H-indolo[2,3-b]quinoline.
| Compound Name | 5-cyclohexyl-2-ethoxy-8-ethynyl-3-(5-fluorosulfonyloxy-3-pyridinyl)-11-oxo-6H-indolo[2,3-b]quinoline |
|---|---|
| PubChem CID | 170295629 |
| Molecular Formula | C30H26FN3O5S |
| Molecular Weight | 559.62 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 5-cyclohexyl-2-ethoxy-8-ethynyl-3-(5-fluorosulfonyloxy-3-pyridinyl)-11-oxo-6H-indolo[2,3-b]quinoline |
| SMILES | C#Cc1ccc2c(c1)[nH]c1c2c(=O)c2cc(OCC)c(-c3cncc(OS(=O)(=O)F)c3)cc2n1C1CCCCC1 |
| InChI | InChI=1S/C30H26FN3O5S/c1-3-18-10-11-22-25(12-18)33-30-28(22)29(35)24-15-27(38-4-2)23(14-26(24)34(30)20-8-6-5-7-9-20)19-13-21(17-32-16-19)39-40(31,36)37/h1,10-17,20,33H,4-9H2,2H3 |
| InChIKey | DTTMLSSDDYMUCF-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|