C30H25FN2O5S — CID 170295287
5-cyclopentyl-2-ethoxy-8-ethynyl-3-(3-fluorosulfonyloxyphenyl)-11-oxo-6H-indolo[2,3-b]quinoline (PubChem CID 170295287) has the molecular formula C30H25FN2O5S and a molecular weight of 544.60 g/mol. Its IUPAC name is 5-cyclopentyl-2-ethoxy-8-ethynyl-3-(3-fluorosulfonyloxyphenyl)-11-oxo-6H-indolo[2,3-b]quinoline.
| Compound Name | 5-cyclopentyl-2-ethoxy-8-ethynyl-3-(3-fluorosulfonyloxyphenyl)-11-oxo-6H-indolo[2,3-b]quinoline |
|---|---|
| PubChem CID | 170295287 |
| Molecular Formula | C30H25FN2O5S |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 5-cyclopentyl-2-ethoxy-8-ethynyl-3-(3-fluorosulfonyloxyphenyl)-11-oxo-6H-indolo[2,3-b]quinoline |
| SMILES | C#Cc1ccc2c(c1)[nH]c1c2c(=O)c2cc(OCC)c(-c3cccc(OS(=O)(=O)F)c3)cc2n1C1CCCC1 |
| InChI | InChI=1S/C30H25FN2O5S/c1-3-18-12-13-22-25(14-18)32-30-28(22)29(34)24-17-27(37-4-2)23(16-26(24)33(30)20-9-5-6-10-20)19-8-7-11-21(15-19)38-39(31,35)36/h1,7-8,11-17,20,32H,4-6,9-10H2,2H3 |
| InChIKey | DVJJVUUUVSBMQJ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|