C32H30FN3O5S — CID 170296914
2-butoxy-8-cyano-5-cyclohexyl-3-(3-fluorosulfonyloxyphenyl)-11-oxo-6H-indolo[2,3-b]quinoline (PubChem CID 170296914) has the molecular formula C32H30FN3O5S and a molecular weight of 587.67 g/mol. Its IUPAC name is 2-butoxy-8-cyano-5-cyclohexyl-3-(3-fluorosulfonyloxyphenyl)-11-oxo-6H-indolo[2,3-b]quinoline.
| Compound Name | 2-butoxy-8-cyano-5-cyclohexyl-3-(3-fluorosulfonyloxyphenyl)-11-oxo-6H-indolo[2,3-b]quinoline |
|---|---|
| PubChem CID | 170296914 |
| Molecular Formula | C32H30FN3O5S |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | 2-butoxy-8-cyano-5-cyclohexyl-3-(3-fluorosulfonyloxyphenyl)-11-oxo-6H-indolo[2,3-b]quinoline |
| SMILES | CCCCOc1cc2c(=O)c3c4ccc(C#N)cc4[nH]c3n(C3CCCCC3)c2cc1-c1cccc(OS(=O)(=O)F)c1 |
| InChI | InChI=1S/C32H30FN3O5S/c1-2-3-14-40-29-18-26-28(17-25(29)21-8-7-11-23(16-21)41-42(33,38)39)36(22-9-5-4-6-10-22)32-30(31(26)37)24-13-12-20(19-34)15-27(24)35-32/h7-8,11-13,15-18,22,35H,2-6,9-10,14H2,1H3 |
| InChIKey | UOHGYHQBYPBCNZ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|