C31H28FN3O5S — CID 170296584
3-[2-butoxy-8-cyano-5-(oxan-4-yl)-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]benzenesulfonyl fluoride (PubChem CID 170296584) has the molecular formula C31H28FN3O5S and a molecular weight of 573.65 g/mol. Its IUPAC name is 3-[2-butoxy-8-cyano-5-(oxan-4-yl)-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]benzenesulfonyl fluoride.
| Compound Name | 3-[2-butoxy-8-cyano-5-(oxan-4-yl)-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 170296584 |
| Molecular Formula | C31H28FN3O5S |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | 3-[2-butoxy-8-cyano-5-(oxan-4-yl)-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]benzenesulfonyl fluoride |
| SMILES | CCCCOc1cc2c(=O)c3c4ccc(C#N)cc4[nH]c3n(C3CCOCC3)c2cc1-c1cccc(S(=O)(=O)F)c1 |
| InChI | InChI=1S/C31H28FN3O5S/c1-2-3-11-40-28-17-25-27(16-24(28)20-5-4-6-22(15-20)41(32,37)38)35(21-9-12-39-13-10-21)31-29(30(25)36)23-8-7-19(18-33)14-26(23)34-31/h4-8,14-17,21,34H,2-3,9-13H2,1H3 |
| InChIKey | YMTIESLSWMGETI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|