C31H28FN3O4S — CID 170295156
3-[2-butoxy-8-ethynyl-5-(1-methylazetidin-3-yl)-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]benzenesulfonyl fluoride (PubChem CID 170295156) has the molecular formula C31H28FN3O4S and a molecular weight of 557.65 g/mol. Its IUPAC name is 3-[2-butoxy-8-ethynyl-5-(1-methylazetidin-3-yl)-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]benzenesulfonyl fluoride.
| Compound Name | 3-[2-butoxy-8-ethynyl-5-(1-methylazetidin-3-yl)-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 170295156 |
| Molecular Formula | C31H28FN3O4S |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | 3-[2-butoxy-8-ethynyl-5-(1-methylazetidin-3-yl)-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]benzenesulfonyl fluoride |
| SMILES | C#Cc1ccc2c(c1)[nH]c1c2c(=O)c2cc(OCCCC)c(-c3cccc(S(=O)(=O)F)c3)cc2n1C1CN(C)C1 |
| InChI | InChI=1S/C31H28FN3O4S/c1-4-6-12-39-28-16-25-27(15-24(28)20-8-7-9-22(14-20)40(32,37)38)35(21-17-34(3)18-21)31-29(30(25)36)23-11-10-19(5-2)13-26(23)33-31/h2,7-11,13-16,21,33H,4,6,12,17-18H2,1,3H3 |
| InChIKey | TYXGLOQLXQETLX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|