C27H20FN3O4S — CID 170295140
3-[5-(azetidin-3-yl)-8-ethynyl-2-methoxy-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]benzenesulfonyl fluoride (PubChem CID 170295140) has the molecular formula C27H20FN3O4S and a molecular weight of 501.54 g/mol. Its IUPAC name is 3-[5-(azetidin-3-yl)-8-ethynyl-2-methoxy-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]benzenesulfonyl fluoride.
| Compound Name | 3-[5-(azetidin-3-yl)-8-ethynyl-2-methoxy-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 170295140 |
| Molecular Formula | C27H20FN3O4S |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 3-[5-(azetidin-3-yl)-8-ethynyl-2-methoxy-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]benzenesulfonyl fluoride |
| SMILES | C#Cc1ccc2c(c1)[nH]c1c2c(=O)c2cc(OC)c(-c3cccc(S(=O)(=O)F)c3)cc2n1C1CNC1 |
| InChI | InChI=1S/C27H20FN3O4S/c1-3-15-7-8-19-22(9-15)30-27-25(19)26(32)21-12-24(35-2)20(11-23(21)31(27)17-13-29-14-17)16-5-4-6-18(10-16)36(28,33)34/h1,4-12,17,29-30H,13-14H2,2H3 |
| InChIKey | KINAGNHWCDBGPJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|