C31H27FN2O3S — CID 170295088
3-(2-butyl-5-cyclobutyl-8-ethynyl-11-oxo-6H-indolo[2,3-b]quinolin-3-yl)benzenesulfonyl fluoride (PubChem CID 170295088) has the molecular formula C31H27FN2O3S and a molecular weight of 526.63 g/mol. Its IUPAC name is 3-(2-butyl-5-cyclobutyl-8-ethynyl-11-oxo-6H-indolo[2,3-b]quinolin-3-yl)benzenesulfonyl fluoride.
| Compound Name | 3-(2-butyl-5-cyclobutyl-8-ethynyl-11-oxo-6H-indolo[2,3-b]quinolin-3-yl)benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 170295088 |
| Molecular Formula | C31H27FN2O3S |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 3-(2-butyl-5-cyclobutyl-8-ethynyl-11-oxo-6H-indolo[2,3-b]quinolin-3-yl)benzenesulfonyl fluoride |
| SMILES | C#Cc1ccc2c(c1)[nH]c1c2c(=O)c2cc(CCCC)c(-c3cccc(S(=O)(=O)F)c3)cc2n1C1CCC1 |
| InChI | InChI=1S/C31H27FN2O3S/c1-3-5-8-21-17-26-28(18-25(21)20-9-6-12-23(16-20)38(32,36)37)34(22-10-7-11-22)31-29(30(26)35)24-14-13-19(4-2)15-27(24)33-31/h2,6,9,12-18,22,33H,3,5,7-8,10-11H2,1H3 |
| InChIKey | NJKPZSJIBHSLDX-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|