C26H20FN3O5S — CID 170295572
2-ethoxy-5-ethyl-8-ethynyl-3-(5-fluorosulfonyloxy-3-pyridinyl)-11-oxo-6H-indolo[2,3-b]quinoline (PubChem CID 170295572) has the molecular formula C26H20FN3O5S and a molecular weight of 505.53 g/mol. Its IUPAC name is 2-ethoxy-5-ethyl-8-ethynyl-3-(5-fluorosulfonyloxy-3-pyridinyl)-11-oxo-6H-indolo[2,3-b]quinoline.
| Compound Name | 2-ethoxy-5-ethyl-8-ethynyl-3-(5-fluorosulfonyloxy-3-pyridinyl)-11-oxo-6H-indolo[2,3-b]quinoline |
|---|---|
| PubChem CID | 170295572 |
| Molecular Formula | C26H20FN3O5S |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 2-ethoxy-5-ethyl-8-ethynyl-3-(5-fluorosulfonyloxy-3-pyridinyl)-11-oxo-6H-indolo[2,3-b]quinoline |
| SMILES | C#Cc1ccc2c(c1)[nH]c1c2c(=O)c2cc(OCC)c(-c3cncc(OS(=O)(=O)F)c3)cc2n1CC |
| InChI | InChI=1S/C26H20FN3O5S/c1-4-15-7-8-18-21(9-15)29-26-24(18)25(31)20-12-23(34-6-3)19(11-22(20)30(26)5-2)16-10-17(14-28-13-16)35-36(27,32)33/h1,7-14,29H,5-6H2,2-3H3 |
| InChIKey | YTQLRFUWNLEKDS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|