C25H18FN3O4S — CID 170295384
5-(2-ethoxy-8-ethynyl-5-methyl-11-oxo-6H-indolo[2,3-b]quinolin-3-yl)pyridine-3-sulfonyl fluoride (PubChem CID 170295384) has the molecular formula C25H18FN3O4S and a molecular weight of 475.50 g/mol. Its IUPAC name is 5-(2-ethoxy-8-ethynyl-5-methyl-11-oxo-6H-indolo[2,3-b]quinolin-3-yl)pyridine-3-sulfonyl fluoride.
| Compound Name | 5-(2-ethoxy-8-ethynyl-5-methyl-11-oxo-6H-indolo[2,3-b]quinolin-3-yl)pyridine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 170295384 |
| Molecular Formula | C25H18FN3O4S |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 5-(2-ethoxy-8-ethynyl-5-methyl-11-oxo-6H-indolo[2,3-b]quinolin-3-yl)pyridine-3-sulfonyl fluoride |
| SMILES | C#Cc1ccc2c(c1)[nH]c1c2c(=O)c2cc(OCC)c(-c3cncc(S(=O)(=O)F)c3)cc2n1C |
| InChI | InChI=1S/C25H18FN3O4S/c1-4-14-6-7-17-20(8-14)28-25-23(17)24(30)19-11-22(33-5-2)18(10-21(19)29(25)3)15-9-16(13-27-12-15)34(26,31)32/h1,6-13,28H,5H2,2-3H3 |
| InChIKey | YJGGAUFMLXTECH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|