C23H15FN4O4S — CID 170297206
5-(8-cyano-2-methoxy-5-methyl-11-oxo-6H-indolo[2,3-b]quinolin-3-yl)pyridine-3-sulfonyl fluoride (PubChem CID 170297206) has the molecular formula C23H15FN4O4S and a molecular weight of 462.46 g/mol. Its IUPAC name is 5-(8-cyano-2-methoxy-5-methyl-11-oxo-6H-indolo[2,3-b]quinolin-3-yl)pyridine-3-sulfonyl fluoride.
| Compound Name | 5-(8-cyano-2-methoxy-5-methyl-11-oxo-6H-indolo[2,3-b]quinolin-3-yl)pyridine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 170297206 |
| Molecular Formula | C23H15FN4O4S |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 5-(8-cyano-2-methoxy-5-methyl-11-oxo-6H-indolo[2,3-b]quinolin-3-yl)pyridine-3-sulfonyl fluoride |
| SMILES | COc1cc2c(=O)c3c4ccc(C#N)cc4[nH]c3n(C)c2cc1-c1cncc(S(=O)(=O)F)c1 |
| InChI | InChI=1S/C23H15FN4O4S/c1-28-19-7-16(13-6-14(11-26-10-13)33(24,30)31)20(32-2)8-17(19)22(29)21-15-4-3-12(9-25)5-18(15)27-23(21)28/h3-8,10-11,27H,1-2H3 |
| InChIKey | NITLORKDKDVOSM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|