C27H23FN4O3S — CID 170297235
5-[8-cyano-5-ethyl-2-(2-methylpropyl)-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]pyridine-3-sulfonyl fluoride (PubChem CID 170297235) has the molecular formula C27H23FN4O3S and a molecular weight of 502.57 g/mol. Its IUPAC name is 5-[8-cyano-5-ethyl-2-(2-methylpropyl)-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]pyridine-3-sulfonyl fluoride.
| Compound Name | 5-[8-cyano-5-ethyl-2-(2-methylpropyl)-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]pyridine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 170297235 |
| Molecular Formula | C27H23FN4O3S |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 5-[8-cyano-5-ethyl-2-(2-methylpropyl)-11-oxo-6H-indolo[2,3-b]quinolin-3-yl]pyridine-3-sulfonyl fluoride |
| SMILES | CCn1c2cc(-c3cncc(S(=O)(=O)F)c3)c(CC(C)C)cc2c(=O)c2c3ccc(C#N)cc3[nH]c21 |
| InChI | InChI=1S/C27H23FN4O3S/c1-4-32-24-11-21(18-9-19(14-30-13-18)36(28,34)35)17(7-15(2)3)10-22(24)26(33)25-20-6-5-16(12-29)8-23(20)31-27(25)32/h5-6,8-11,13-15,31H,4,7H2,1-3H3 |
| InChIKey | DCQVNJMMKDTPMZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|