C27H21FN2O4S — CID 170295229
2,5-diethyl-8-ethynyl-3-(3-fluorosulfonyloxyphenyl)-11-oxo-6H-indolo[2,3-b]quinoline (PubChem CID 170295229) has the molecular formula C27H21FN2O4S and a molecular weight of 488.54 g/mol. Its IUPAC name is 2,5-diethyl-8-ethynyl-3-(3-fluorosulfonyloxyphenyl)-11-oxo-6H-indolo[2,3-b]quinoline.
| Compound Name | 2,5-diethyl-8-ethynyl-3-(3-fluorosulfonyloxyphenyl)-11-oxo-6H-indolo[2,3-b]quinoline |
|---|---|
| PubChem CID | 170295229 |
| Molecular Formula | C27H21FN2O4S |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 2,5-diethyl-8-ethynyl-3-(3-fluorosulfonyloxyphenyl)-11-oxo-6H-indolo[2,3-b]quinoline |
| SMILES | C#Cc1ccc2c(c1)[nH]c1c2c(=O)c2cc(CC)c(-c3cccc(OS(=O)(=O)F)c3)cc2n1CC |
| InChI | InChI=1S/C27H21FN2O4S/c1-4-16-10-11-20-23(12-16)29-27-25(20)26(31)22-14-17(5-2)21(15-24(22)30(27)6-3)18-8-7-9-19(13-18)34-35(28,32)33/h1,7-15,29H,5-6H2,2-3H3 |
| InChIKey | BEMFVSLCIHRCRC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|