C26H19FN2O3S — CID 170295038
3-(5-ethyl-8-ethynyl-2-methyl-11-oxo-6H-indolo[2,3-b]quinolin-3-yl)benzenesulfonyl fluoride (PubChem CID 170295038) has the molecular formula C26H19FN2O3S and a molecular weight of 458.51 g/mol. Its IUPAC name is 3-(5-ethyl-8-ethynyl-2-methyl-11-oxo-6H-indolo[2,3-b]quinolin-3-yl)benzenesulfonyl fluoride.
| Compound Name | 3-(5-ethyl-8-ethynyl-2-methyl-11-oxo-6H-indolo[2,3-b]quinolin-3-yl)benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 170295038 |
| Molecular Formula | C26H19FN2O3S |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 3-(5-ethyl-8-ethynyl-2-methyl-11-oxo-6H-indolo[2,3-b]quinolin-3-yl)benzenesulfonyl fluoride |
| SMILES | C#Cc1ccc2c(c1)[nH]c1c2c(=O)c2cc(C)c(-c3cccc(S(=O)(=O)F)c3)cc2n1CC |
| InChI | InChI=1S/C26H19FN2O3S/c1-4-16-9-10-19-22(12-16)28-26-24(19)25(30)21-11-15(3)20(14-23(21)29(26)5-2)17-7-6-8-18(13-17)33(27,31)32/h1,6-14,28H,5H2,2-3H3 |
| InChIKey | FFVUXHQFXUYBPK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|