C28H23FN2O3S — CID 170295040
3-(5-ethyl-8-ethynyl-11-oxo-2-propan-2-yl-6H-indolo[2,3-b]quinolin-3-yl)benzenesulfonyl fluoride (PubChem CID 170295040) has the molecular formula C28H23FN2O3S and a molecular weight of 486.57 g/mol. Its IUPAC name is 3-(5-ethyl-8-ethynyl-11-oxo-2-propan-2-yl-6H-indolo[2,3-b]quinolin-3-yl)benzenesulfonyl fluoride.
| Compound Name | 3-(5-ethyl-8-ethynyl-11-oxo-2-propan-2-yl-6H-indolo[2,3-b]quinolin-3-yl)benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 170295040 |
| Molecular Formula | C28H23FN2O3S |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 3-(5-ethyl-8-ethynyl-11-oxo-2-propan-2-yl-6H-indolo[2,3-b]quinolin-3-yl)benzenesulfonyl fluoride |
| SMILES | C#Cc1ccc2c(c1)[nH]c1c2c(=O)c2cc(C(C)C)c(-c3cccc(S(=O)(=O)F)c3)cc2n1CC |
| InChI | InChI=1S/C28H23FN2O3S/c1-5-17-10-11-20-24(12-17)30-28-26(20)27(32)23-14-21(16(3)4)22(15-25(23)31(28)6-2)18-8-7-9-19(13-18)35(29,33)34/h1,7-16,30H,6H2,2-4H3 |
| InChIKey | ZZVSQADQRBBVCJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|