C55H47N — CID 170297032
N-(4-cyclohexa-1,3-dien-1-ylphenyl)-N-(9,9-dimethylfluoren-2-yl)-10,10-dimethyl-5-phenyl-4,12-dihydro-3H-indeno[1,2-h]fluoren-9-amine (PubChem CID 170297032) has the molecular formula C55H47N and a molecular weight of 721.99 g/mol. Its IUPAC name is N-(4-cyclohexa-1,3-dien-1-ylphenyl)-N-(9,9-dimethylfluoren-2-yl)-10,10-dimethyl-5-phenyl-4,12-dihydro-3H-indeno[1,2-h]fluoren-9-amine.
| Compound Name | N-(4-cyclohexa-1,3-dien-1-ylphenyl)-N-(9,9-dimethylfluoren-2-yl)-10,10-dimethyl-5-phenyl-4,12-dihydro-3H-indeno[1,2-h]fluoren-9-amine |
|---|---|
| PubChem CID | 170297032 |
| Molecular Formula | C55H47N |
| Molecular Weight | 721.99 g/mol |
| Exact Mass | 721.37 |
| IUPAC Name | N-(4-cyclohexa-1,3-dien-1-ylphenyl)-N-(9,9-dimethylfluoren-2-yl)-10,10-dimethyl-5-phenyl-4,12-dihydro-3H-indeno[1,2-h]fluoren-9-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(C4=CC=CCC4)cc3)c3cccc4c3C(C)(C)c3cc5c(c(-c6ccccc6)c3-4)C3=C(C=CCC3)C5)cc21 |
| InChI | InChI=1S/C55H47N/c1-54(2)46-24-14-13-22-43(46)44-31-30-41(34-47(44)54)56(40-28-26-36(27-29-40)35-16-7-5-8-17-35)49-25-15-23-45-52-48(55(3,4)53(45)49)33-39-32-38-20-11-12-21-42(38)50(39)51(52)37-18-9-6-10-19-37/h5-7,9-11,13-16,18-20,22-31,33-34H,8,12,17,21,32H2,1-4H3 |
| InChIKey | MILWZKNLJXNIGT-UHFFFAOYSA-N |
| XLogP | 14.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.99 |
| LogP ≤ 5 | 14.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |